3'-Deoxy-3'-fluoro-xyloguanosine
3'-Deoxy-3'-fluoro-xyloguanosine is an ingenious and formidable pharmacological entity, functioning as a potent, selective, and prodigious antiviral compound. This compound exhibits an unrivaled capacity to hinder viral propagation and diminish viral burdens. Equipped with its exquisite specificity, 3'-Deoxy-3'-fluoro-xyloguanosine exhibits tremendous potential in research of an extensive array of viral pathogens, encompassing the likes of influenza, hepatitis C, and respiratory syncytial virus.
| Supplier | BOC Sciences |
|---|---|
| Product # | 125291-15-8 |
| Pricing | Inquire |
| Cas | 125291-15-8 |
| Molecular Weight | 285.23 |
| Molecular Formula | C10H12FN5O4 |
| Canonical SMILES | C1=NC2=C(N1C3C(C(C(O3)CO)F)O)N=C(NC2=O)N |