3,5-Diiodo-L-tyrosine dihydrate
3,5-Diiodo-L-tyrosine dihydrate is a widely employed compound assuming a pivotal function in the synthesand regulation of thyroid hormones. Its application extends to studying diverse thyroid disorders, including hyperthyroidism and goiter.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-008065 |
| Pricing | Inquire |
| Cas | 18835-59-1 |
| Molecular Weight | 469.01 |
| Molecular Formula | C9H13I2NO5 |
| Canonical SMILES | C1=C(C=C(C(=C1I)O)I)CC(C(=O)O)N.O.O |