3'-Amino-3'-deoxy-5'-O-DMT-thymidine
3'-Amino-3'-deoxy-5'-O-DMT-thymidine, a fundamental compound extensively employed in the field of biomedicine, holds immense significance. Its utility spans nucleic acid labeling, DNA synthesis, and the development of antiviral drugs. By proficiently targeting viral DNA replication, this compound exhibits exceptional potential in combatting a wide range of viral diseases, including the notable HIV/AIDS.
| Supplier | BOC Sciences |
|---|---|
| Product # | 139063-29-9 |
| Pricing | Inquire |
| Cas | 139063-29-9 |
| Molecular Weight | 543.61 |
| Molecular Formula | C31H33N3O6 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2CC(C(O2)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)N |