Piperafizine A
It is a methylated diketopiperazine formed by the condensation of phenylalanine and is produced by many species in the genus Streptomyces. It exhibits little activity in vitro but potentiates vincristine antitumour potency.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-03965 |
| Pricing | Inquire |
| Cas | 130603-59-7 |
| Molecular Weight | 304.34 |
| Molecular Formula | C19H16N2O2 |
| Canonical SMILES | CN1C(=CC2=CC=CC=C2)C(=O)NC(=CC3=CC=CC=C3)C1=O |