2,2-Bis(4-hydroxy-3-cyclohexylphenyl)propane
2,2-Bis(4-hydroxy-3-cyclohexylphenyl)propane is an instrumental organic compound with notable biomedical implications. Predominantly, synthesis of avant-garde pharmaceutical agents employs this central molecule, targeting a spectrum of pathological conditions, notably cancer, and pathologies of cardiovascular nature.
| Supplier | BOC Sciences |
|---|---|
| Product # | 57100-74-0 |
| Pricing | Inquire |
| Cas | 57100-74-0 |
| Molecular Weight | 392.57 |
| Molecular Formula | C27H36O2 |
| Canonical SMILES | CC(C)(C1=CC(=C(C=C1)O)C2CCCCC2)C3=CC(=C(C=C3)O)C4CCCCC4 |