6-Chloro-9-(2-O-acetyl-5-O-benzoyl-3-azido-3-deoxy-beta-D-ribofuranosyl)-9H-purine
This compound is a potent nucleoside analogue widely used in the biomedical industry. Its antiviral properties make it an effective research for viral infections such as herpes and hepatitis. Additionally, it exhibits anticancer activity, particularly in the research of leukemia and solid tumors. This compound plays a crucial role in inhibiting viral replication and suppressing tumor growth.
| Supplier | BOC Sciences |
|---|---|
| Product # | 917239-29-3 |
| Pricing | Inquire |
| Cas | 917239-29-3 |
| Molecular Weight | 457.83 |
| Molecular Formula | C19H16ClN7O5 |
| Canonical SMILES | CC(=O)OC1C(C(OC1N2C=NC3=C2N=CN=C3Cl)COC(=O)C4=CC=CC=C4)N=[N+]=[N-] |