2,3,4-Tri-O-benzyl-b-L-arabinopyranose
2,3,4-Tri-O-benzyl-b-L-arabinopyranose, a paramount compound within the biomedical sector, assumes an indispensable position. This invaluable product actively participates in the synthesis of groundbreaking antiviral medications, notably designed to combat viral afflictions encompassing HIV and influenza. By virtue of its distinct configuration, it orchestrates targeted hindrance of viral enzymes, thereby obstructing viral reproduction.
| Supplier | BOC Sciences |
|---|---|
| Product # | 77943-33-0 |
| Pricing | Inquire |
| Cas | 77943-33-0 |
| Molecular Weight | 420.51 |
| Molecular Formula | C26H28O5 |
| Canonical SMILES | C1C(C(C(C(O1)O)OCC2=CC=CC=C2)OCC3=CC=CC=C3)OCC4=CC=CC=C4 |