Fmoc-Nε-dimethyl-L-lysine hydrochloride
Di-Me L-lysine derivative. The methylation of lysine in histone tails is a common posttranslational modification that functions in histone-regulated chromatin condensation, with binding of methylated lysine occurring in aromatic pockets on chromodomain proteins.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-003794 |
| Pricing | Inquire |
| Cas | 252049-10-8 |
| Molecular Weight | 432.95 |
| Molecular Formula | C23H28N2O4·HCl |
| Canonical SMILES | CN(C)CCCCC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13.Cl |