CYCLOHEXYL P-TOLUENESULFONATE
CYCLOHEXYL P-TOLUENESULFONATE is a highly significant pharmaceutical compound extensively utilized in the biomedical industry. Its paramount significance lies in its application for the treatment of afflictions including but not limited to inflammatory disorders, cardiovascular diseases, and even certain forms of cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 953-91-3 |
| Pricing | Inquire |
| Cas | 953-91-3 |
| Molecular Weight | 254.35 |
| Molecular Formula | C13H18O3S |
| Canonical SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2CCCCC2 |