Amidepsine D
It is produced by the strain of Humicola sp. FO-2942. It inhibits DGAT activity, and the IC50 of rat liver microsomes DGAT is 17.5 X 10-6 mol/L. It also inhibits triacylglycerol formation in intact Raji cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-00672 |
| Pricing | Inquire |
| Cas | 79786-34-8 |
| Molecular Weight | 496.46 |
| Molecular Formula | C26H24O10 |
| Canonical SMILES | CC1=CC(=CC(=C1C(=O)O)O)OC(=O)C2=C(C=C(C=C2C)OC(=O)C3=C(C=C(C=C3C)OC)OC)O |