DMT-Hexylamine-linker Phosphoramidite
DMT-Hexylamine-linker Phosphoramidite is utilized in oligonucleotide synthesis and contains a 4,4'-dimethoxytrityl (DMT) protecting group attached to a hexylamine linker via a phosphoramidite moiety. The hexylamine linker allows for the conjugation of oligonucleotides to various molecules, surfaces, or probes, facilitating applications such as nucleic acid labeling, immobilization, or conjugation to solid supports for affinity purification or detection purposes.
| Supplier | BOC Sciences |
|---|---|
| Product # | BRP-00633 |
| Pricing | Inquire |
| Cas | 116919-15-4 |
| Molecular Weight | 619.77 |
| Molecular Formula | C36H50N3O4P |
| Canonical SMILES | N#CCCOP(OCCCCCCNC(C=1C=CC=CC1)(C2=CC=C(OC)C=C2)C3=CC=C(OC)C=C3)N(C(C)C)C(C)C |