1,1-BIS(3-CYCLOHEXYL-4-HYDROXYPHENYL)CYCLOHEXANE
1,1-BIS(3-CYCLOHEXYL-4-HYDROXYPHENYL)CYCLOHEXANE is a novel compound used in biomedical research. Due to its antioxidant, anti-apoptotic and neuroprotective properties, it has potential therapeutic use in the field of drug development for the treatment of neurological disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 4221-68-5 |
| Pricing | Inquire |
| Cas | 4221-68-5 |
| Molecular Weight | 432.64 |
| Molecular Formula | C30H40O2 |
| Canonical SMILES | C1CCC(CC1)C2=C(C=CC(=C2)C3(CCCCC3)C4=CC(=C(C=C4)O)C5CCCCC5)O |