Diundecyl Phthalate (mixture of branched chain isomers)
Diundecyl Phthalate is a mixture of branched chain isomers that is a chemical compound primarily used in the biomedical industry as a plasticizer. It is often employed in the formulation of medical devices, such as catheters and blood bags, to enhance their flexibility and durability. Additionally, it finds application in the production of pharmaceutical coatings and carriers due to its film-forming properties and biocompatibility.
| Supplier | BOC Sciences |
|---|---|
| Product # | 96507-86-7 |
| Pricing | Inquire |
| Cas | 96507-86-7 |
| Molecular Weight | 474.73 |
| Molecular Formula | C30H50O4 |
| Canonical SMILES | CC(C)CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCCC(C)C |