4-(2-Propen-1-yl)-1,2-benzenediol 1-Methanesulfonate
4-(2-Propen-1-yl)-1,2-benzenediol 1-Methanesulfonate is an intermediate in the synthesis of Eugenol (E935640), a dental compound which shows cytotoxicity to human oral squamous cell carcinoma and oral cells. When glucosylated, this compound exhibits anti-inflammatory activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB058044 |
| Pricing | Inquire |
| Cas | 115234-25-8 |
| Molecular Weight | 228.26 |
| Molecular Formula | C10H12O4S |
| Canonical SMILES | CS(=O)(=O)OC1=C(C=C(C=C1)CC=C)O |