6-Chloro-9-(2,3,5-tri-O-benzoyl-2-C-methyl-β-D-ribofuranosyl)-9H-purine
6-Chloro-9-(2,3,5-tri-O-benzoyl-2-C-methyl-β-D-ribofuranosyl)-9H-purine, commonly known as a remarkable antiviral agent, holds immense significance in the biomedical realm. It emerges as a key player in combating RNA viruses, through its intricate interactions with viral enzymes. By impeding their replication, this compound effectively curtails viral proliferation and transmission.
| Supplier | BOC Sciences |
|---|---|
| Product # | 205171-04-6 |
| Pricing | Inquire |
| Cas | 205171-04-6 |
| Molecular Weight | 613.02 |
| Molecular Formula | C32H25ClN4O7 |
| Canonical SMILES | CC1(C(C(OC1N2C=NC3=C2N=CN=C3Cl)COC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5)OC(=O)C6=CC=CC=C6 |