Lenalidomide-d5
Lenalidomide-d5 is a deuterated form of Lenalidomide. Lenalidomide (CC-5013) is a derivative of Thalidomide and functions as an orally active immunomodulator. It acts through cereblon-mediated selective ubiquitination and degradation of IKZF1 and IKZF3 lymphocyte transcription factors, inhibiting the growth of mature B-cell lymphomas including multiple myeloma, and inducing interleukin-2 (IL-2) release from T cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-012406 |
| Pricing | Inquire |
| Cas | 1227162-34-6 |
| Molecular Weight | 264.29 |
| Molecular Formula | C13H8D5N3O3 |
| Canonical SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=CC=C3N |