CCT245737(S)
CCT245737, a nitrogen heterocycle compound, has been found to be a CHK1 inhibitor that could probable be effective in antineoplastic studies. It is still under Phase I trail for Solid tumours. IC50: 30-220 nM.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1489389-23-2 |
| Pricing | Inquire |
| Cas | 1489389-23-2 |
| Molecular Weight | 379.14 |
| Molecular Formula | C16H16F3N7O |
| Canonical SMILES | C1COC(CN1)CNC2=CC(=NC=C2C(F)(F)F)NC3=NC=C(N=C3)C#N |