5'-DMT-2'-O-TBDMS-PseudoUridine-CE-Phosphoramidite
5'-DMT-2'-O-TBDMS-PseudoUridine-CE-Phosphoramidite is a valuable compound primarily employed for the research and development of RNA molecules required for diagnostic purposes or therapeutic interventions. This compound plays a crucial role in the development of drugs targeting specific diseases and disorders, such as cancers or viral infections. It facilitates efficient nucleotide incorporation and ensures accurate development of RNA sequences.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2706-337807 |
| Pricing | Inquire |
| Cas | 163496-23-9 |
| Molecular Weight | 861.05 |
| Molecular Formula | C45H61N4O9PSi |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1C(OC(C1O[Si](C)(C)C(C)(C)C)C2=CNC(=O)NC2=O)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC |