Verrucarin A
It is produced by the strain of Myrothecium verrucaria NRRL 3003. Verrucarin A has the effect of anti-Gram-negative bacteria and fungi, inhibiting Newcastle disease virus, tobacco Mosaic virus, and S-37 sarcoma and Yoshida sarcoma in animals.
| Supplier | BOC Sciences |
|---|---|
| Product # | 3148-09-2 |
| Pricing | Inquire |
| Cas | 3148-09-2 |
| Molecular Weight | 502.55 |
| Molecular Formula | C27H34O9 |
| Canonical SMILES | CC1CCOC(=O)C=CC=CC(=O)OC2CC3C4(C2(C5(CCC(=CC5O3)C)COC(=O)C1O)C)CO4 |