2-(Dimethylaminomethylidene)amino-9-(β-D-2-deoxyribofuranosyl)purine
2-(Dimethylaminomethylidene)amino-9-(β-D-2-deoxyribofuranosyl)purine is a vital compound used in the biomedical industry. Its therapeutic potential lies in treating various diseases, including viral infections and certain types of cancer. With its unique chemical structure, this compound exhibits potent antiviral and antitumor activities, making it a promising candidate for developing targeted therapies. Extensive research has demonstrated its efficacy in inhibiting viral replication and suppressing tumor growth, offering new hope for patients in need of effective treatments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 869355-02-2 |
| Pricing | Inquire |
| Cas | 869355-02-2 |
| Molecular Weight | 306.28 |
| Molecular Formula | C13H18N6O3 |
| Canonical SMILES | CN(C)C=NC1=NC=C2C(=N1)N(C=N2)C3CC(C(O3)CO)O |