2-Pyridinecarboxamide, 4-[[6-[[[[4-chloro-3-(trifluoromethyl)phenyl]amino]iminomethyl]amino]-3-pyridinyl]oxy]-N-methyl-
2-Pyridinecarboxamide, 4-[[6-[[[[4-chloro-3-(trifluoromethyl)phenyl]amino]iminomethyl]amino]-3-pyridinyl]oxy]-N-methyl- is a potent aryl-guanidino inhibitor. It inhibits cell proliferation, induces G2/M cell cycle arrest and apoptosis. It also inhibits the activation of the PI3K/AKT pathway by downregulating the protein expression of PI3K and phosphorylation of AKT.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2136278-38-9 |
| Pricing | Inquire |
| Cas | 2136278-38-9 |
| Molecular Weight | 464.83 |
| Molecular Formula | C20H16ClF3N6O2 |
| Canonical SMILES | CNC(=O)C1=NC=CC(=C1)OC2=CN=C(C=C2)N=C(N)NC3=CC(=C(C=C3)Cl)C(F)(F)F |