Butirosin A
Butirosin A is an aminoglycoside antibiotic produced by acillus circulans. It has activity against gram-positive bacteria, negative bacteria, and mycobacteria. It is not cross-resistant to gentamicin, and has an effect on some kanamycin-resistant bacteria.
| Supplier | BOC Sciences |
|---|---|
| Product # | 34291-02-6 |
| Pricing | Inquire |
| Cas | 34291-02-6 |
| Molecular Weight | 555.57 |
| Molecular Formula | C21H41N5O12 |
| Canonical SMILES | C1C(C(C(C(C1NC(=O)C(CCN)O)O)OC2C(C(C(O2)CO)O)O)OC3C(C(C(C(O3)CN)O)O)N)N |