BAM 15
BAM 15 is a novel mitochondrial protonophore uncoupler that uncouples oxidative phosphorylation in L6 myoblast mitochondria in vitro (EC50 = 270 nM). BAM 15 cannot depolarize the plasma membrane, and protects mice from acute renal ischemic-reperfusion injury. BAM 15 has the potential to treat obesity, Parkinson's disease, and aging.
| Supplier | BOC Sciences |
|---|---|
| Product # | B1370-119162 |
| Pricing | 100 mg/unit USD $398 |
| Cas | 210302-17-3 |
| Molecular Weight | 340.29 |
| Molecular Formula | C16H10F2N6O |
| Canonical SMILES | C1=CC=C(C(=C1)NC2=NC3=NON=C3N=C2NC4=CC=CC=C4F)F |