3'-O-Acetyl-5'-O-DMT-2'-O-methyl-5-naphthyl-b-methylaminocarbonyl-uridine
Modified uridine, 3'-O-Acetyl-5'-O-DMT-2'-O-methyl-5-naphthyl-b-methylaminocarbonyl-uridine, is a vital component in biomedicine research. Its application is typically directed towards nucleotide analogs creation, particularly in the fight against hepatitis C and HIV. Its impact in antiviral therapy is unequivocal, and as such, commands utmost attention in scientific research.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2095417-00-6 |
| Pricing | Inquire |
| Cas | 2095417-00-6 |
| Molecular Weight | 785.84 |
| Molecular Formula | C45H43N3O10 |
| Canonical SMILES | CC(=O)OC1C(OC(C1OC)N2C=C(C(=O)NC2=O)C(=O)NCC3=CC4=CC=CC=C4C=C3)COC(C5=CC=CC=C5)(C6=CC=C(C=C6)OC)C7=CC=C(C=C7)OC |