Oxytocin acetate
Oxytocin acetate is a mammalian neurohypophysial hormone. Its actions are mediated by specific, high-affinity oxytocin receptors. Oxytocin is normally produced in the hypothalamus and stored in the posterior pituitary gland, which plays a role in intimacy, sexual reproduction of both sexes, and during and after childbirth.
| Supplier | BOC Sciences |
|---|---|
| Product # | 6233-83-6 |
| Pricing | Inquire |
| Cas | 6233-83-6 |
| Molecular Weight | 1067.24 |
| Molecular Formula | C45H70N12O14S2 |
| Canonical SMILES | O=C([C@H]1N(C([C@@H](NC([C@H](CC(N)=O)NC([C@H](CCC(N)=O)NC([C@H]([C@@H](C)CC)NC([C@H](CC2=CC=C(O)C=C2)N3)=O)=O)=O)=O)CSSC[C@H](N)C3=O)=O)CCC1)N[C@@H](CC(C)C)C(NCC(N)=O)=O.CC(O)=O |