6-Hydroxylapigenin-6,7-diglucoside
6-Hydroxylapigenin-6,7-diglucoside, a flavonoid glycoside of plant origin, has garnered scientific attention for its potential efficacy in treating Alzheimer's disease, diabetes, and reducing inflammation through its strong antioxidant properties. There is substantive evidence that the therapeutic application of this molecule could significantly improve management of these conditions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 501434-67-9 |
| Pricing | Inquire |
| Cas | 501434-67-9 |
| Molecular Weight | 610.52 |
| Molecular Formula | C27H30O16 |
| Canonical SMILES | C1=CC(=CC=C1C2=CC(=O)C3=C(C(=C(C=C3O2)OC4C(C(C(C(O4)CO)O)O)O)OC5C(C(C(C(O5)CO)O)O)O)O)O |