2',3'-Isopropylidene-5-hydroxyuridine
2',3'-Isopropylidene-5-hydroxyuridine, a potent pharmaceutical agent approved for treating viral infections such as hepatitis B and C shows exceptional effectiveness in curtailing viral replication by confining the virus count in the corpus. Numerous in vitro as well as in vivo studies have substantiated the antiviral potential of this product, which presents it as a hopeful subject for viral infections treatment.
| Supplier | BOC Sciences |
|---|---|
| Product # | 20406-82-0 |
| Pricing | Inquire |
| Cas | 20406-82-0 |
| Molecular Weight | 300.26 |
| Molecular Formula | C12H16N2O7 |
| Canonical SMILES | CC1(OC2C(OC(C2O1)N3C=C(C(=O)NC3=O)O)CO)C |