Brexpiprazole S-oxide
Brexpiprazole S-oxide is a main metabolite of Brexpiprazole and is metabolized by cytochrome P450 3A4 (CYP3A4). Brexpiprazole is an atypical antipsychotic agent and a partial agonist of human 5-HT1A and dopamine receptor.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1191900-51-2 |
| Pricing | Inquire |
| Cas | 1191900-51-2 |
| Molecular Weight | 449.57 |
| Molecular Formula | C25H27N3O3S |
| Canonical SMILES | C1CN(CCN1CCCCOC2=CC3=C(C=C2)C=CC(=O)N3)C4=C5C=CS(=O)C5=CC=C4 |