4-Nitrophenyl 4,6-cyclohexylidene-b-D-mannopyranoside
4-Nitrophenyl 4,6-cyclohexylidene-b-D-mannopyranoside, an indispensably significant compound in the realm of biomedical research, emerges as a fundamental player in the exploration of carbohydrate metabolism and elucidation of glycosidases and their inhibitors.
| Supplier | BOC Sciences |
|---|---|
| Product # | 102717-16-8 |
| Pricing | Inquire |
| Cas | 102717-16-8 |
| Molecular Weight | 381.38 |
| Molecular Formula | C18H23NO8 |
| Canonical SMILES | C1CCC2(CC1)OCC3C(O2)C(C(C(O3)OC4=CC=C(C=C4)[N+](=O)[O-])O)O |