8-Benzyloxyadenosine
8-Benzyloxyadenosine is a key compound in biomedicine used for its potential therapeutic benefits in treating various diseases. It acts as an adenosine receptor agonist, primarily targeting A1 and A3 receptors. This unique property makes it an essential tool in studying the role of adenosine receptors in conditions such as cardiovascular diseases, cancer, and neurodegenerative disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 131265-29-7 |
| Pricing | Inquire |
| Cas | 131265-29-7 |
| Molecular Weight | 373.36 |
| Molecular Formula | C17H19N5O5 |
| Canonical SMILES | C1=CC=C(C=C1)COC2=NC3=C(N=CN=C3N2C4C(C(C(O4)CO)O)O)N |