1H-Indene-2-boronic acid pinacol ester
1H-Indene-2-boronic acid pinacol ester, a chemical garniture utilized as a determinant constituent in the formulation of pharmaceutical compounds, leverages an integral significance in biomedical fields. Predominantly, it is employed to contrive medicinal agents that combat diverse cardiovascular pathologies and inflammatory conditions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 749869-98-5 |
| Pricing | Inquire |
| Cas | 749869-98-5 |
| Molecular Weight | 242.12 |
| Molecular Formula | C15H19BO2 |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=CC=CC=C3C2 |