Pomalidomide-C3-NH2 hydrochloride
Pomalidomide-C3-NH2 hydrochloride is a synthetic E3 ligase ligand-linker conjugate containing a cereblon ligand based on Pomalidomide and a C3 alkyl linker with terminal amine, as a part of a variety of functionalized PROTAC molecules for binding to a target protein ligand.
| Supplier | BOC Sciences |
|---|---|
| Product # | BP-100133 |
| Pricing | Inquire |
| Cas | 2154342-45-5 |
| Molecular Weight | 366.80 |
| Molecular Formula | C₁₆H₁₉ClN₄O₄ |
| Canonical SMILES | NCCCNC1=C2C(N(C(C2=CC=C1)=O)C3CCC(NC3=O)=O)=O.Cl |