a-D-Glucoheptonic acid sodium salt
a-D-Glucoheptonic acid sodium salt is a multifaceted compound with remarkable chelating attributes, proving to be a fundamental ingredient as a pharmaceutical intermediary or augmentative component in diverse compound compositions.
Supplier | BOC Sciences |
---|---|
Product # | 13007-85-7 |
Pricing | Inquire |
Cas | 13007-85-7 |
Molecular Weight | 248.16 |
Molecular Formula | C7H13O8Na |
Canonical SMILES | C(C(C(C(C(C(C(=O)[O-])O)O)O)O)O)O.[Na+] |