17-Oxo Dexamethasone
17-Oxo Dexamethasone is an exceedingly influential synthetic glucocorticoid imbued with remarkable anti-inflammatory and immunosuppressive attributes. This paramount product finds its purpose in studying a myriad of perplexing inflammatory ailments, most notably rheumatoid arthritis , asthma and allergic reactions.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0731-263435 |
| Pricing | Inquire |
| Cas | 1880-61-1 |
| Molecular Weight | 332.41 |
| Molecular Formula | C20H25FO3 |
| Canonical SMILES | CC1CC2C3CCC4=CC(=O)C=CC4(C3(C(CC2(C1=O)C)O)F)C |