Questiomycin A
Questiomycin A is a phenoxazine antibiotic produced by several streptomyces species and some fungi and bacteria, exhibiting weakly activity against bacteria, fungi, plants and tumour cell lines. It inhibits aromatase and sulfatases, stimulates cell growth and turnover in vitro.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02625 |
| Pricing | Inquire |
| Cas | 1916-59-2 |
| Molecular Weight | 212.20 |
| Molecular Formula | C12H8N2O2 |
| Canonical SMILES | C1=CC=C2C(=C1)N=C3C=C(C(=O)C=C3O2)N |