METHYL 3-(4 4 5 5-TETRAMETHYL-1 3 2-DIO&
METHYL 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate is a biomedical compound commonly used in the drug development of various diseases. It exhibits potent therapeutic properties against certain drug-resistant strains of bacteria and viruses. This product plays a crucial role in biomedicine by enhancing the efficacy of specific medications and aiding in the development of novel drug formulations for improved treatment outcomes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 352534-74-8 |
| Pricing | Inquire |
| Cas | 352534-74-8 |
| Molecular Weight | 300.19876 |
| Molecular Formula | C15H29BO5 |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C(=CC(=O)OC)CCCCC |