D-Iopamidol
D-Iopamidol is an indispensable biomedical contrast agent for high-quality diagnostic imaging to revolutionize the field of diagnostic imaging. This remarkable contrast agent takes the lead in its application during radiographic procedures, deftly augmenting the visual prowess of blood vessels in the immersive research of angiography.
| Supplier | BOC Sciences |
|---|---|
| Product # | 60208-45-9 |
| Pricing | Inquire |
| Cas | 60208-45-9 |
| Molecular Weight | 777.08 |
| Molecular Formula | C17H22I3N3O8 |
| Canonical SMILES | CC(C(=O)NC1=C(C(=C(C(=C1I)C(=O)NC(CO)CO)I)C(=O)NC(CO)CO)I)O |