Phenyl b-D-thioglucopyranoside
Phenyl b-D-thioglucopyranoside is an indispensable biomedical product within the pharmaceutical industry unraveling its potential in drug discovery and development studies. Notably, its distinctive chemical configuration renders it a remarkable compound in enzyme assays and as a substrate for enzyme-catalyzed reactions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2936-70-1 |
| Pricing | Inquire |
| Cas | 2936-70-1 |
| Molecular Weight | 272.32 |
| Molecular Formula | C12H16O5S |
| Canonical SMILES | C1=CC=C(C=C1)SC2C(C(C(C(O2)CO)O)O)O |