Jatropholone B
Jatropholone B is a bioactive ingredient derived from Jatropha curcas, exhibiting commendable anti-inflammatory attributes, rendering it a suitable contender for studying a spectrum of ailments encompassing cancer, diabetes and cardiovascular complexities.
| Supplier | BOC Sciences |
|---|---|
| Product # | 71386-38-4 |
| Pricing | Inquire |
| Cas | 71386-38-4 |
| Molecular Weight | 296.41 |
| Molecular Formula | C20H24O2 |
| Canonical SMILES | CC1CC2=C(C(=C3C4C(C4(C)C)CCC(=C)C3=C2C1=O)C)O |