1,6:2,3-Dianhydro-4-O-(2,3,4,6-tetra-O-acetyl-b-D-glucopyranosyl)-b-D-mannopyranose
Purportedly an efficacious chemical in inhibiting the pathological propagation of bacteria and viruses, 1,6:2,3-Dianhydro-4-O-(2,3,4,6-tetra-O-acetyl-b-D-glucopyranosyl)-b-D-mannopyranose is a vital substance involved in the biomedical field. Its mechanism of action involves significantly impeding the growth and spreading of deleterious microorganisms within the human body, resulting in the treatment and prevention of bacterial and viral infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 103702-87-0 |
| Pricing | Inquire |
| Cas | 103702-87-0 |
| Molecular Weight | 474.41 |
| Molecular Formula | C20H26O13 |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)OC2C3COC(O3)C4C2O4)OC(=O)C)OC(=O)C)OC(=O)C |