Micafungin Epimer Impurity
Micafungin Epimer Impurity is an impurity of Micafungin, an echinocandin antifungal drug which inhibits the synthesis of 1,3-β-D-glucan, an essential component of the fungal cell wall, and represent a valuable treatment option for fungal infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1392514-05-4 |
| Pricing | Inquire |
| Cas | 1392514-05-4 |
| Molecular Weight | 1292.26 |
| Molecular Formula | C56H70N9NaO23S |
| Canonical SMILES | CCCCCOC1=CC=C(C=C1)C2=CC(=NO2)C3=CC=C(C=C3)C(=O)NC4CC(C(NC(=O)C5C(C(CN5C(=O)C(NC(=O)C(NC(=O)C6CC(CN6C(=O)C(NC4=O)C(C)O)O)C(C(C7=CC(=C(C=C7)O)OS(=O)(=O)[O-])O)O)C(CC(=O)N)O)C)O)O)O.[Na+] |