sodium 2-[(2-aminoethyl)amino]ethanesulphonate
Sodium 2-[(2-aminoethyl)amino]ethanesulphonate, also known as amiloride, is a pharmacological agent employed in the management of cystic fibrosis to alleviate pulmonary manifestations through its mucolytic properties. This compound exerts its therapeutic effects by promoting the liquefaction of respiratory secretions, thereby facilitating expectoration and enhancing pulmonary clearance mechanisms.
| Supplier | BOC Sciences |
|---|---|
| Product # | 34730-59-1 |
| Pricing | Inquire |
| Cas | 34730-59-1 |
| Molecular Weight | 190.19651 |
| Molecular Formula | C4H11N2NaO3S |
| Canonical SMILES | C(CNCCS(=O)(=O)[O-])N.[Na+] |