2',3'-Di-O-isopropylidene-isocytidine
2',3'-Di-O-isopropylidene-isocytidine is a efficacious antiviral compound, employed in the realm of biomedical science for research of combating diverse viral infections such as hepatitis B and hepatitis C. By virtue of its profound ability to impede viral replication and hamper the synthesis of viral RNA, this exceptional compound contributes to the development of antiviral therapeutic modalities.
| Supplier | BOC Sciences |
|---|---|
| Product # | 5975-05-3 |
| Pricing | Inquire |
| Cas | 5975-05-3 |
| Molecular Weight | 283.28 |
| Molecular Formula | C12H17N3O5 |
| Canonical SMILES | CC1(OC2C(OC(C2O1)N3C=CC(=O)N=C3N)CO)C |