Saikosaponin A
Saikosaponin A, a triterpenoid glycoside, induces apoptotic mechansims in human breast cancer cell lines. It also displays an inhibitory activity against allergic asthma. It mediates the inflammatory response by inhibiting the MAPK and NF-κB pathways in LPS-stimulated RAW 264.7 cells. It as antioxidants improve antioxidant status.
Supplier | BOC Sciences |
---|---|
Product # | NP7012 |
Pricing | Inquire |
Cas | 20736-09-8 |
Molecular Weight | 780.98 |
Molecular Formula | C42H68O13 |
Canonical SMILES | CC1C(C(C(C(O1)OC2CCC3(C(C2(C)CO)CCC4(C3C=CC56C4(CC(C7(C5CC(CC7)(C)C)CO6)O)C)C)C)O)OC8C(C(C(C(O8)CO)O)O)O)O |