Narasin sodium
It is a polyether antibiotic produced by Str. aureo faciens NRRL 5758. It has broad spectrum activity against gram-positive bacteria, anaerobic bacteria and mycoplasma. It also has antiviral and limited antifungal activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-04279 |
| Pricing | Inquire |
| Cas | 58331-17-2 |
| Molecular Weight | 787.01 |
| Molecular Formula | C43H71NaO11 |
| Canonical SMILES | CCC(C1C(CC(C(O1)C(C)C(C(C)C(=O)C(CC)C2C(CC(C3(O2)C=CC(C4(O3)CCC(O4)(C)C5CCC(C(O5)C)(CC)O)O)C)C)O)C)C)C(=O)[O-].[Na+] |