6-Carboxyfluorescein dipivalate
6-Carboxyfluorescein dipivalate is a fluorescent dye that has been used in a variety of scientific research applications, including biochemistry, physiology and cell biology. 6-Carboxyfluorescein dipivalate emits light under ultraviolet excitation and is used to study the structure and function of proteins and to detect and quantify cellular components. In addition, it is used to study the biochemical and physiological effects of drugs and to monitor the progression of various diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 192374-17-7 |
| Pricing | Inquire |
| Cas | 192374-17-7 |
| Molecular Weight | 544.55 |
| Molecular Formula | C31H28O9 |
| Canonical SMILES | CC(C)(C)C(=O)OC1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)OC(=O)C(C)(C)C)C5=C(C=CC(=C5)C(=O)O)C(=O)O3 |