Naphthol AS-MX acetate
Naphthol AS-MX acetate is a chemical compound widely used in the biomedical industry. It acts as an efficient dye for the detection of oxidative damage in cellular DNA and proteins. This product is particularly useful in research related to cancer treatment and diagnosis, as it aids in identifying potential therapeutic targets and monitoring disease progression.
| Supplier | BOC Sciences |
|---|---|
| Product # | 4569-00-0 |
| Pricing | Inquire |
| Cas | 4569-00-0 |
| Molecular Weight | 333.38 |
| Molecular Formula | C21H19NO3 |
| Canonical SMILES | CC1=CC(=C(C=C1)NC(=O)C2=CC3=CC=CC=C3C=C2OC(=O)C)C |