5-Bromo-2-chlorobenzoic acid
5-Bromo-2-chlorobenzoic acid (CAS# 21739-92-4) is used as a starting material in the synthesis of Dapagliflozin (D185370), a selective sodium-glucose cotransporter-2 inhibitor that reduces renal glucose reabsorption and is used to treat patients with type 2 diabetes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 21739-92-4 |
| Pricing | Inquire |
| Cas | 21739-92-4 |
| Molecular Weight | 235.46 |
| Molecular Formula | C7H4BrClO2 |
| Canonical SMILES | C1=CC(=C(C=C1Br)C(=O)O)Cl |