4'-epi-Emtricitabine 4-Acetamide 5'-O-Benzoyl
4'-epi-Emtricitabine 4-Acetamide 5'-O-Benzoyl is a protected intermediate in the synthesis of ent-Emtricitabine, a reverse transcriptase inhibitor that is effective antiviral agent against HIV, HBV, and other viruses replicating in a similar manner.
| Supplier | BOC Sciences |
|---|---|
| Product # | 150796-39-7 |
| Pricing | Inquire |
| Cas | 150796-39-7 |
| Molecular Weight | 393.39 |
| Molecular Formula | C17H16FN3O5S |
| Canonical SMILES | CC(=O)NC1=NC(=O)N(C=C1F)C2CSC(O2)COC(=O)C3=CC=CC=C3 |