1-Hexyl-3-methylimidazolium Bromide
1-Hexyl-3-methylimidazolium Bromide (CAS# 85100-78-3) is a compound that is produced as part of industrial processes, then released into the environment. 1-Hexyl-3-methylimidazolium bromide is toxic to freshwater algae, plankton and other aquatic organisms. 1-Hexyl-3-methylimidazolium bromide also possesses some antimicrobial activity.
Supplier | BOC Sciences |
---|---|
Product # | BB037472 |
Pricing | Inquire |
Cas | 85100-78-3 |
Molecular Weight | 247.18 |
Molecular Formula | C10H19BrN2 |
Canonical SMILES | CCCCCCN1C=C[N+](=C1)C.[Br-] |